Norfenefrine hydrochloride
Catalog No: FT-0630425
CAS No: 15308-34-6
- Chemical Name: Norfenefrine hydrochloride
- Molecular Formula: C8H11NO2
- Molecular Weight: 153.18
- InChI Key: LRCXRAABFLIVAI-UHFFFAOYSA-N
- InChI: InChI=1S/C8H11NO2/c9-5-8(11)6-2-1-3-7(10)4-6/h1-4,8,10-11H,5,9H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | N/A |
|---|---|
| CAS: | 15308-34-6 |
| MF: | C8H12ClNO2 |
| Melting_Point: | 162-164 °C(lit.) |
| Symbol: | Warning |
| Density: | N/A |
| FW: | 189.639 |
| Product_Name: | Norphenylephrine Hydrochloride |
| Flash_Point: | N/A |
| Exact_Mass: | 189.055649 |
|---|---|
| MF: | C8H12ClNO2 |
| FW: | 189.639 |
| More_Info: | ['1. Appearance Unknow ', '2. Density(g/mL,25/4℃)Unknow ', '3. Relative vapor density(g/mL,Atmosphere =1)Unknow ', '4. Melting point(ºC)162-164 ', '5. Boiling point(ºC,Atmospheric pressure)Unknow ', '6. Boiling point(ºC,52kPa)Unknow ', '7. Refractive indexUnknow ', '8. Flash point(ºC)Unknow ', '9. Specific rotation(º)Unknow ', '10. Spontaneous ignition point or ignition temperature(ºC)Unknow ', '11. Vapor pressure(kPa,25ºC)Unknow ', '12. Saturated vapor pressure(kPa,60ºC)Unknow ', '13. Combustion heat(KJ/mol)Unknow ', '14. Critical temperature(ºC)Unknow ', '15. Critical pressure(KPa)Unknow ', '16. Oil-water(Octanol /Water )Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion(%,V/V)Unknow ', '18. Lower limit of explosion(%,V/V)Unknow ', '19. Solubility Unknow'] |
| PSA: | 66.48000 |
| LogP: | 1.88660 |
| Computational_Chemistry: | ['1 . XlogP '] |
| Melting_Point: | 162-164 °C(lit.) |
| WGK_Germany: | 3 |
|---|---|
| Symbol: | Warning |
| HS_Code: | 2922509090 |
| Safety_Statements: | S22 |
| Hazard_Codes: | Xn |
| RTECS: | DN7400000 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R22 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)